Phenol, 4-ethenyl-3,5-dimethoxy- manufacturers
|
| | Phenol, 4-ethenyl-3,5-dimethoxy- Basic information |
| Product Name: | Phenol, 4-ethenyl-3,5-dimethoxy- | | Synonyms: | Phenol, 4-ethenyl-3,5-dimethoxy-;3,5-dimethoxy-4-vinylphenol;3,5-dimethoxy-4-vinylphenol (Phenol, 4-ethenyl-3,5-dimethoxy- );4-Ethenyl-3,5-dimethoxyphenol | | CAS: | 335162-53-3 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | | | Product Categories: | | | Mol File: | 335162-53-3.mol |  |
| | Phenol, 4-ethenyl-3,5-dimethoxy- Chemical Properties |
| Boiling point | 323.2±37.0 °C(Predicted) | | density | 1.113±0.06 g/cm3(Predicted) | | pka | 9.26±0.36(Predicted) | | InChI | InChI=1S/C10H12O3/c1-4-8-9(12-2)5-7(11)6-10(8)13-3/h4-6,11H,1H2,2-3H3 | | InChIKey | LHUWFIJCDKAODB-UHFFFAOYSA-N | | SMILES | C1(O)=CC(OC)=C(C=C)C(OC)=C1 |
| | Phenol, 4-ethenyl-3,5-dimethoxy- Usage And Synthesis |
| | Phenol, 4-ethenyl-3,5-dimethoxy- Preparation Products And Raw materials |
|