| Company Name: |
GLP Pharma Standards
|
| Tel: |
+91 9866074638 |
| Email: |
info@glppharmastandards.com |
| Products Intro: |
Product Name:Escitalopram desmethyl compound D CAS:62498-67-3 Purity:NLT 95% Package:25 MG 50 MG 100 MG 250 MG EXTRA
|
|
| | 1-(4-fluorophenyl)-1,3-dihydro-1-[3-(methylamino)propyl]isobenzofuran-5-carbonitrile Basic information |
| | 1-(4-fluorophenyl)-1,3-dihydro-1-[3-(methylamino)propyl]isobenzofuran-5-carbonitrile Chemical Properties |
| InChI | InChI=1S/C19H19FN2O/c1-22-10-2-9-19(16-4-6-17(20)7-5-16)18-8-3-14(12-21)11-15(18)13-23-19/h3-8,11,22H,2,9-10,13H2,1H3 | | InChIKey | PTJADDMMFYXMMG-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(F)C=C2)(CCCNC)C2=C(C=C(C#N)C=C2)CO1 |
| | 1-(4-fluorophenyl)-1,3-dihydro-1-[3-(methylamino)propyl]isobenzofuran-5-carbonitrile Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A metabolite of Citalopram, an inhibitor of serotonin (5-HT) uptake, 1-(4-fluorophenyl)-1,3-dihydro-1-[3-(methylamino)propyl]isobenzofuran-5-carbonitrile can be used as an antidepressant. | | Definition | ChEBI: Demethylcitalopram is an organic amino compound and a member of benzenes. |
| | 1-(4-fluorophenyl)-1,3-dihydro-1-[3-(methylamino)propyl]isobenzofuran-5-carbonitrile Preparation Products And Raw materials |
|