2-ethylhexyl (4-chloro-2-methylphenoxy)acetate manufacturers
|
| | 2-ethylhexyl (4-chloro-2-methylphenoxy)acetate Basic information |
| Product Name: | 2-ethylhexyl (4-chloro-2-methylphenoxy)acetate | | Synonyms: | MCPA-2-ETHYLHEXYL ESTER PESTANAL;Acetic acid, (4-chloro-2-methylphenoxy)-, 2-ethylhexyl ester;2-Ethylhexyl ((4-chloro-o-tolyl)oxy)acetate;Acetic acid, ((4-chloro-o-tolyl)oxy)-, 2-ethylhexyl ester;Einecs 249-636-2;4-Chloro-2-methylphenoxyacetic acid 2-ethylhexyl ester;2-(4-chlorophenoxy)propanoic acid 2-ethylhexyl ester;Mcpa-2-ethylhexyl | | CAS: | 29450-45-1 | | MF: | C17H25ClO3 | | MW: | 312.83 | | EINECS: | 249-636-2 | | Product Categories: | | | Mol File: | 29450-45-1.mol |  |
| | 2-ethylhexyl (4-chloro-2-methylphenoxy)acetate Chemical Properties |
| Boiling point | 387.3±27.0 °C(Predicted) | | density | 1.063 | | vapor pressure | 0.003Pa at 20℃ | | refractive index | n20/D (effective) | | Fp | >100 °C | | Major Application | agriculture
environmental | | InChI | 1S/C17H25ClO3/c1-4-6-7-14(5-2)11-21-17(19)12-20-16-9-8-15(18)10-13(16)3/h8-10,14H,4-7,11-12H2,1-3H3 | | InChIKey | IDGRPSMONFWWEK-UHFFFAOYSA-N | | SMILES | CCCCC(CC)COC(=O)COc1ccc(Cl)cc1C | | LogP | -1.12-4.49 at 20℃ and pH4-10 | | EPA Substance Registry System | MCPA-2-ethylhexyl (29450-45-1) |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-50/53-20/21/22 | | Safety Statements | 26-60-61-13 | | RIDADR | UN3082 9/PG 3 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 |
| | 2-ethylhexyl (4-chloro-2-methylphenoxy)acetate Usage And Synthesis |
| Uses | MCPA-2-ethylhexyl Ester is related to (4-Chloro-2-methylphenoxy)acetic Acid (C369470), which is a pesticide. | | reaction suitability | reagent type: derivatization reagent
reaction type: Esterifications |
| | 2-ethylhexyl (4-chloro-2-methylphenoxy)acetate Preparation Products And Raw materials |
|