- Sodium Cocoyl Glycinate
-
- $0.00 / 1KG
-
2026-05-22
- CAS:90387-74-9
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- Sodium Cocoyl Glycinate
-
- $2.00 / 25KG
-
2026-04-17
- CAS:90387-74-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons
|
| | Sodium Cocoyl Glycinate Basic information |
| Product Name: | Sodium Cocoyl Glycinate | | Synonyms: | N-Cocoacylglycine sodium salts;Glycine, N-coco acyl derivs., sodium salts;SODIUM COCOYL GLYCINATE;Galsoft Sodium Cocoyl Glycinate;Sodium N-Cocoyl Glycinate;N-cocoyl Glycine Sodium Salt;Sodium Cocoyl Glycinate 30% liquid;Glycine, N-coco acyl derivs., sodium salts USP/EP/BP | | CAS: | 90387-74-9 | | MF: | C14H26NNaO3 | | MW: | 279.35091 | | EINECS: | 291-350-5 | | Product Categories: | | | Mol File: | 90387-74-9.mol |  |
| | Sodium Cocoyl Glycinate Chemical Properties |
| density | 1.137g/cm3 at 20℃ | | vapor pressure | 0-0.001Pa at 20-25℃ | | form | Solid | | Cosmetics Ingredients Functions | HAIR CONDITIONING SKIN CONDITIONING CLEANSING | | InChI | InChI=1S/C14H27NO3.Na/c1-2-3-4-5-6-7-8-9-10-11-13(16)15-12-14(17)18;/h2-12H2,1H3,(H,15,16)(H,17,18);/q;+1/p-1 | | InChIKey | IKGKWKGYFJBGQJ-UHFFFAOYSA-M | | SMILES | [Na+].C([O-])(=O)CNC(=O)CCCCCCCCCCC | | LogP | 1 at 20℃ and pH7.4 |
| | Sodium Cocoyl Glycinate Usage And Synthesis |
| Uses | Sodium Cocoyl Glycinate is a mild surfactant, even milder than its úcousinù, Sodium Cocoyl Glutamate. The mixture of both, plus Cocamidopropyl Hydroxysultaine ensures that dirt, make-up, sunscreen, and excess sebum is washed away while leaving your skin supple and hydrated. One challenge of Sodium Cocoyl Glycinate is that it precipitates at low pH, making it unsuitable in products formulated with a pH lower than 5.
| | Definition | Sodium Cocoyl Glycinate is another amino acid-based surfactant that is composed of Glycine and a fatty acid. Since Glycine is the smallest amino acid, it allows for the surfactant to have a considerably smaller charged head compared to other anionic surfactants. Because of this, it is less damaging to the Stratum Corneum (SC) compared to other anionics. |
| | Sodium Cocoyl Glycinate Preparation Products And Raw materials |
|