2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one manufacturers
|
| | 2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one Basic information |
| Product Name: | 2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one | | Synonyms: | 2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one;Norepinephrine EP Impurity B;2-AMINO-3,4-DIHYDROXYACETOPHENONE;noradrenalone;2-Amino-1-(3,4-dihydroxyphenyl)ethanone;4-Aminoaceto-1,2-dihydroxybenzene;Arterenone;α-Amino-3',4'-dihydroxyacetophenone | | CAS: | 499-61-6 | | MF: | C8H9NO3 | | MW: | 167.16 | | EINECS: | 207-883-3 | | Product Categories: | | | Mol File: | 499-61-6.mol |  |
| | 2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one Chemical Properties |
| Melting point | 235 °C (decomp) | | Boiling point | 435.1±40.0 °C(Predicted) | | density | 1.375±0.06 g/cm3(Predicted) | | pka | 7.89±0.20(Predicted) | | InChI | InChI=1S/C8H9NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,10-11H,4,9H2 | | InChIKey | CNFQARFTXUBHJY-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C(O)=C1)CN |
| | 2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one Usage And Synthesis |
| Preparation | Preparation by reaction of 35% aqueous ammonia with 3,4-dihydroxy-a-chloroacetophenone in methanol or in ethanol. |
| | 2-amino-1-(3,4-dihydroxyphenyl)ethan-1-one Preparation Products And Raw materials |
|