- Naphthalene-2,7-diamine
-
- $0.00 / 100gram
-
2022-06-02
- CAS:613-76-3
- Min. Order: 25gram
- Purity: 98.0% HPLC
- Supply Ability: 50 kilogram
|
| | naphthalene-2,7-diamine Basic information |
| Product Name: | naphthalene-2,7-diamine | | Synonyms: | naphthalene-2,7-diamine;2,7-Naphthylenediamine;NSC 356142;2,7-Naphthalenediamine (7CI, 8CI, 9CI, ACI);Naphthalen-2,7-diamine | | CAS: | 613-76-3 | | MF: | C10H10N2 | | MW: | 158.2 | | EINECS: | 210-353-4 | | Product Categories: | | | Mol File: | 613-76-3.mol |  |
| | naphthalene-2,7-diamine Chemical Properties |
| Melting point | 166-167℃ | | Boiling point | 395.7±15.0 °C(Predicted) | | density | 1.234±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 4.68±0.10(Predicted) | | Appearance | Gray to brown Solid | | InChI | InChI=1S/C10H10N2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6H,11-12H2 | | InChIKey | HBJPJUGOYJOSLR-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC(N)=C2)=CC=C1N |
| | naphthalene-2,7-diamine Usage And Synthesis |
| | naphthalene-2,7-diamine Preparation Products And Raw materials |
|