- Pyromeconic acid
-
- $36.00
-
2026-04-22
- CAS:496-63-9
- Purity: 99.85%
- Supply Ability: 10g
|
| | 3-hydroxy-4H-pyran-4-one Basic information |
| | 3-hydroxy-4H-pyran-4-one Chemical Properties |
| Melting point | 117-118°C | | Boiling point | 298.7±40.0 °C(Predicted) | | density | 1.483±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.16±0.10(Predicted) | | color | White to Beige | | InChI | InChI=1S/C5H4O3/c6-4-1-2-8-3-5(4)7/h1-3,7H | | InChIKey | VEYIMQVTPXPUHA-UHFFFAOYSA-N | | SMILES | C1OC=CC(=O)C=1O | | EPA Substance Registry System | 4H-Pyran-4-one, 3-hydroxy- (496-63-9) |
| | 3-hydroxy-4H-pyran-4-one Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | Pyromeconic acid is an important intermediate of synthesizing maltoland its homologous. |
| | 3-hydroxy-4H-pyran-4-one Preparation Products And Raw materials |
|