| Company Name: |
Xi'an ZB Biotech Co.,Ltd
|
| Tel: |
|
| Email: |
sales03@xazbbio.com |
| Products Intro: |
Product Name:fluindione
CAS:957-56-2
Purity:99% Package:1KG;5KG;25KG
|
- Fluindione
-
- $159.00 / 5mg
-
2026-03-12
- CAS:957-56-2
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | fluindione Basic information |
| Product Name: | fluindione | | Synonyms: | fluorindione;2-(4-fluorophenyl)indane-1,3-quinone;2-(4-fluorophenyl)indene-1,3-dione;2-(4-Fluorophenyl)-1H-indene-1,3(2H)-dione;2-(p-Fluorophenyl)-1,3-indandione;LM 123;Previscan;1H-Indene-1,3(2H)-dione, 2-(4-fluorophenyl)- | | CAS: | 957-56-2 | | MF: | C15H9FO2 | | MW: | 240.23 | | EINECS: | 213-484-5 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 957-56-2.mol |  |
| | fluindione Chemical Properties |
| Melting point | 120° | | Boiling point | 406.3±45.0 °C(Predicted) | | density | 1.335±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.41±0.20(Predicted) | | color | Dark Red to Very Dark Purple | | InChI | 1S/C15H9FO2/c16-10-7-5-9(6-8-10)13-14(17)11-3-1-2-4-12(11)15(13)18/h1-8,13H | | InChIKey | NASXCEITKQITLD-UHFFFAOYSA-N | | SMILES | O=C1C2=C(C(C1C3=CC=C(C=C3)F)=O)C=CC=C2 |
| RIDADR | 2811 | | WGK Germany | WGK 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 orally in mice: 240 mg/kg (Fontaine) |
| | fluindione Usage And Synthesis |
| Chemical Properties | Dark Purple Solid | | Uses | A vitamin K antagonist with anticoagulant applications | | Definition | ChEBI: Fluindione is a member of indanones and a cyclic ketone. | | Biological Activity | Fluindione is an orally active vitamin K antagonist (VKA) th at exerts its in vivo anticoagulant efficacy by inhibiting the vitamin K epoxide reductase activity (VKOR IC50 = 6.6 nM) in a substrate-comeptitive manner. |
| | fluindione Preparation Products And Raw materials |
|