|
|
| | 3-formylbut-2-enyl acetate Basic information | | Synthesis |
| Product Name: | 3-formylbut-2-enyl acetate | | Synonyms: | 3-formylbut-2-enyl acetate;4-Acetyloxy-2-methyl-2-butenal;Acetic acid 3-formyl-2-butenyl ester;Einecs 238-989-8;2-Butenal, 4-(acetyloxy)-2-methyl-;Vitamin A Impurity 69 (Mixture of E/Z-isomers);3-methyl-4-oxobut-2-enyl acetate | | CAS: | 14918-80-0 | | MF: | C7H10O3 | | MW: | 142.15 | | EINECS: | 238-989-8 | | Product Categories: | | | Mol File: | 14918-80-0.mol |  |
| | 3-formylbut-2-enyl acetate Chemical Properties |
| Melting point | 50-55 °C | | Boiling point | 95-97 °C(Press: 15 Torr) | | density | 1.027±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C7H10O3/c1-6(5-8)3-4-10-7(2)9/h3,5H,4H2,1-2H3 | | InChIKey | LPDDKAJRWGPGSI-UHFFFAOYSA-N | | SMILES | C(=O)C(C)=CCOC(C)=O |
| | 3-formylbut-2-enyl acetate Usage And Synthesis |
| Synthesis | Vitamin A intermediated C5,namely 3- formylbut- 2- enyl acetate,which was used C15 + C5 synthesis route of vitamin A. 2- Chloro- 1- ethanol was used as starting material,esterified by acetic anhydride and protected by phosphate ester,and then reacted with 1,1- dimethoxy- 2propanone,trans- γ- acetoxytiglic aldehyde dimethyl acetal can be obtained,subsequently deprotection and 3- formylbut- 2- enyl acetate can be achieved. | | Uses | 3-Formylcrotyl Acetate can be used as a vitamin A intermediate. |
| | 3-formylbut-2-enyl acetate Preparation Products And Raw materials |
|