bis(2-ethylhexyl) phenyl phosphite manufacturers
|
| | bis(2-ethylhexyl) phenyl phosphite Basic information |
| Product Name: | bis(2-ethylhexyl) phenyl phosphite | | Synonyms: | bis(2-ethylhexyl) phenyl phosphite;Di(2-Ethyl Hexyl)Monophenyl Phosphite;Phenyl dioctyl phosphite;phosphorous acid, bis(2-ethylhexyl) phenyl ester;Dioctyl phenyl phosphite;Phosphorous acid phenylbis(2-ethylhexyl) ester;Phenyl Diisooctyl Phosphite(PDOP);ANTIOXIDANT TRUELICHT PDOP | | CAS: | 3164-60-1 | | MF: | C22H39O3P | | MW: | 382.52 | | EINECS: | 2216241 | | Product Categories: | | | Mol File: | 3164-60-1.mol |  |
| | bis(2-ethylhexyl) phenyl phosphite Chemical Properties |
| Boiling point | 415.1±18.0 °C(Predicted) | | InChI | InChI=1S/C22H39O3P/c1-5-9-14-20(7-3)18-23-26(25-22-16-12-11-13-17-22)24-19-21(8-4)15-10-6-2/h11-13,16-17,20-21H,5-10,14-15,18-19H2,1-4H3 | | InChIKey | AAQUCXJJDQZZOJ-UHFFFAOYSA-N | | SMILES | P(OC1=CC=CC=C1)(OCC(CC)CCCC)OCC(CC)CCCC | | EPA Substance Registry System | Phosphorous acid, bis(2-ethylhexyl) phenyl ester (3164-60-1) |
| | bis(2-ethylhexyl) phenyl phosphite Usage And Synthesis |
| | bis(2-ethylhexyl) phenyl phosphite Preparation Products And Raw materials |
|