|
|
| | L-Phenylalanine-13C9 (9CI) Basic information |
| Product Name: | L-Phenylalanine-13C9 (9CI) | | Synonyms: | L-Phenylalanine-13C9 (9CI);13C9]-L-PHENYLALANINE (99%);L-Phenylalanine-carboxy,α,β,1,2,3,4,5,6-13C9;L-Phenylalanine-13C9;L-Phenylalanine-13C? (9CI);L-Phenylalanine (13C?, 99%) | | CAS: | 439685-11-7 | | MF: | C9H11NO2 | | MW: | 174.12 | | EINECS: | | | Product Categories: | | | Mol File: | 439685-11-7.mol |  |
| | L-Phenylalanine-13C9 (9CI) Chemical Properties |
| density | 1.202±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | crystals | | color | White to off-white | | InChI | 1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1 | | InChIKey | COLNVLDHVKWLRT-ZNZHEFIISA-N | | SMILES | O[13C]([13C@@H](N)[13CH2][13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1)=O | | CAS Number Unlabeled | 63-91-2 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | L-Phenylalanine-13C9 (9CI) Usage And Synthesis |
| Uses | L-Phenylalanine-13C9 is used in live-cell quantitative imaging of proteome degradation by stimulated Ramen scattering. | | IC 50 | NMDA Receptor |
| | L-Phenylalanine-13C9 (9CI) Preparation Products And Raw materials |
|