1-ethyl-1,2-dihydro-5H-tetrazol-5-one manufacturers
|
| | 1-ethyl-1,2-dihydro-5H-tetrazol-5-one Basic information |
| Product Name: | 1-ethyl-1,2-dihydro-5H-tetrazol-5-one | | Synonyms: | 5H-Tetrazol-5-one,1-ethyl-1,2-dihydro-;1-Ethyltetrazolinone;1-Ethyl-1,4-dihydro-5H-tetrazol-5-one;1-Ethyl-1,4-dihydro-5H-tetrazol-5-one,98+%;1-ethyl-1,2-dihydro-5H-tetrazol-5-one;1-Ethyl-1H-tetrazol-5(4H)-one;1-ethyl-2H-1,2,3,4-tetrazol-5-one;1-ethyl-2H-tetrazol-5-one | | CAS: | 69048-98-2 | | MF: | C3H6N4O | | MW: | 114.11 | | EINECS: | 273-844-2 | | Product Categories: | Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 69048-98-2.mol |  |
| | 1-ethyl-1,2-dihydro-5H-tetrazol-5-one Chemical Properties |
| Melting point | 80℃ | | Boiling point | 121℃ | | density | 1.55 | | Fp | 27℃ | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Dichloromethane (Slightly) | | pka | -1.42±0.20(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C3H6N4O/c1-2-7-3(8)4-5-6-7/h2H2,1H3,(H,4,6,8) | | InChIKey | YVVZUMUVGRLSRZ-UHFFFAOYSA-N | | SMILES | N1(CC)C(=O)N=NN1 |
| Safety Statements | 22-24/25 | | HS Code | 29339900 |
| | 1-ethyl-1,2-dihydro-5H-tetrazol-5-one Usage And Synthesis |
| Chemical Properties | BEIGE-BROWNISH CRYSTALS OR POWDER | | Uses | Intermediate for the synthesis of Alfentanil |
| | 1-ethyl-1,2-dihydro-5H-tetrazol-5-one Preparation Products And Raw materials |
|