|
|
| | (S)-2-Amino-5-methoxytetralin Hydrochloride Basic information |
| Product Name: | (S)-2-Amino-5-methoxytetralin Hydrochloride | | Synonyms: | RT-1;(S)-2-AMINO-5-METHOXYTETRAHYDRONAPHTHALENE HCL;(S)-2-Amino-5-methoxytetrahydronaphthalene hydrochloride;(S)-2-Amino-5-methoxytetralin hydrochloride;4-tetrahydro-5-Methoxy-;(S)-5-Methoxy-1,2,3,4-tetrahydronaphthalen-2-aMine hydrochloride;2-NaphthalenaMine, 1,2,3,4-tetrahydro-5-Methoxy-, hydrochloride, (2S)-;(2S)-5-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride | | CAS: | 58349-17-0 | | MF: | C11H15NO.HCl | | MW: | 213.7 | | EINECS: | 611-645-8 | | Product Categories: | Research | | Mol File: | 58349-17-0.mol |  |
| | (S)-2-Amino-5-methoxytetralin Hydrochloride Chemical Properties |
| Melting point | 262-265 °C | | Boiling point | 283.85℃[at 101 325 Pa] | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to off-white Solid | | Water Solubility | 39.6g/L at 20℃ | | InChI | InChI=1/C11H15NO.ClH/c1-13-11-4-2-3-8-7-9(12)5-6-10(8)11;/h2-4,9H,5-7,12H2,1H3;1H/t9-;/s3 | | InChIKey | CGLCAQWQPIFKRX-OVMXBOEKNA-N | | SMILES | C1C2=C(C(OC)=CC=C2)CC[C@@H]1N.[H]Cl |&1:11,r| | | LogP | -1.52 at 22℃ |
| | (S)-2-Amino-5-methoxytetralin Hydrochloride Usage And Synthesis |
| Chemical Properties | White solid | | Uses | (S)-5-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine Hydrochloride is an intermediate for Rotigotine (R700700), which is a non-ergot dopamine agonist drug and is indicated for the treatment of Parkinson’s disease. |
| | (S)-2-Amino-5-methoxytetralin Hydrochloride Preparation Products And Raw materials |
|