|
|
| | 2,7-Dibromo-9,9-diphenylfluororene Basic information |
| Product Name: | 2,7-Dibromo-9,9-diphenylfluororene | | Synonyms: | 2,7-Dibromo-9,9-diphenyl-fluororene;2,7-Dibromo-9,9-diphenyl-9H-fluorene;2,7-broMo-9,9-diphenyl-9HFluorene;2,7-DibroMo-9,9-diphenylfluorene,9,9-diphenyl-2,7-dibroMofluorene;9H-Fluorene,2,7-dibroMo-9,9-diphenyl-;2,7-Dibromo-9,9-diphenylfluorene;9,9-Diphenyl-2,7-dibromofluorene;2,7-Dibromo-9,9-diph | | CAS: | 186259-63-2 | | MF: | C25H16Br2 | | MW: | 476.2 | | EINECS: | 1533716-785-6 | | Product Categories: | OLED materials,pharm chemical,electronic;Fluorene Series;Electronic Chemicals;Fluorene Derivatives | | Mol File: | 186259-63-2.mol |  |
| | 2,7-Dibromo-9,9-diphenylfluororene Chemical Properties |
| Melting point | 279-281 °C | | Boiling point | 520.3±50.0 °C(Predicted) | | density | 1.548±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C25H16Br2/c26-19-11-13-21-22-14-12-20(27)16-24(22)25(23(21)15-19,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-16H | | InChIKey | AJYDOCCGNIBJBY-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)(C2=CC=CC=C2)C2=C(C=CC(Br)=C2)C2=C1C=C(Br)C=C2 |
| | 2,7-Dibromo-9,9-diphenylfluororene Usage And Synthesis |
| Uses | 2,7-Dibromo-9,9-diphenylfluorene is an OLED intermediate. OLED (Organic Light Emitting Diodes) is a flat light-emitting technology made by placing a series of organic thin films between two conductors. When an electrical current is applied, a bright light is emitted.
|
| | 2,7-Dibromo-9,9-diphenylfluororene Preparation Products And Raw materials |
|