|
|
| | Carbamic acid, methyl(4-oxocyclohexyl)-, 1,1-dimethylethyl ester Basic information |
| Product Name: | Carbamic acid, methyl(4-oxocyclohexyl)-, 1,1-dimethylethyl ester | | Synonyms: | Carbamic acid, methyl(4-oxocyclohexyl)-, 1,1-dimethylethyl ester;4-(N-Boc-N-methylamino)cyclohexanone;CarbaMic acid, N-Methyl-N-(4-oxocyclohexyl)-, 1,1-diMethylethyl ester;tert-butyl N-Methyl-N-(4-oxocyclohexyl)carbaMate;N-methyl-N-(4-oxocyclohexyl)Carbamic acid 1,1-dimethylethyl ester;tert-Butyl methyl(4-oxocyclohexyl);N-methyl-N-(4-oxocyclohexyl)carbamic acid tert-butyl ester;4-(N-Boc-Methylamino)Cyclohexanone | | CAS: | 400899-84-5 | | MF: | C12H21NO3 | | MW: | 227.3 | | EINECS: | | | Product Categories: | | | Mol File: | 400899-84-5.mol |  |
| | Carbamic acid, methyl(4-oxocyclohexyl)-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 316.6±31.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | -1.45±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H21NO3/c1-12(2,3)16-11(15)13(4)9-5-7-10(14)8-6-9/h9H,5-8H2,1-4H3 | | InChIKey | JAMGILZSPQRPBH-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)N(C)C1CCC(=O)CC1 |
| | Carbamic acid, methyl(4-oxocyclohexyl)-, 1,1-dimethylethyl ester Usage And Synthesis |
| | Carbamic acid, methyl(4-oxocyclohexyl)-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|