- Estradiol hemihydrate
-
- $0.00 / 100g/Bag
-
2026-05-19
- CAS:35380-71-3
- Min. Order: 100g
- Purity: 97.0% ~ 103.0%; EP9.5
- Supply Ability: 250kg/month
- Estradiol hemihydrate
-
- $0.00 / 1Gram
-
2026-04-24
- CAS:35380-71-3
- Min. Order: 1Gram
- Purity: 98%
- Supply Ability: 50KG
|
| | Estradiol hemihydrate Basic information | | Uses |
| Product Name: | Estradiol hemihydrate | | Synonyms: | BETA-OESTRADIOL VETRANAL, 250 MG;beta-Estradiol semihydrate;Estra-1,3,5(10)-triene-3,17-diol(17b)-, hydrate (2:1);(8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol,hydrate;EESTRADIOL HEMIHYDRATE;Estradiol Hemihydrates;Estradiol hemihydrateQ: What is
Estradiol hemihydrate Q: What is the CAS Number of
Estradiol hemihydrate Q: What is the storage condition of
Estradiol hemihydrate;Estradiol (1250008) | | CAS: | 35380-71-3 | | MF: | C18H24O2.H2O | | MW: | 290.4 | | EINECS: | 631-198-2 | | Product Categories: | | | Mol File: | 35380-71-3.mol |  |
| | Estradiol hemihydrate Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | BRN | 1914275 | | Major Application | pharmaceutical
pharmaceutical small molecule | | InChI | InChI=1/C18H24O2.H2O/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3;1H2/t14,15-,16,17-,18+;/s3 | | InChIKey | QJNCGXGNKJUDEM-KEFFNRLXNA-N | | SMILES | C12CC[C@@H](O)[C@@]1(C)CCC1C3C=CC(O)=CC=3CC[C@@]21[H].O |&1:3,5,19,r| |
| Hazard Codes | T | | Risk Statements | 60-63-40-64 | | Safety Statements | 53-36/37-45 | | WGK Germany | 3 | | HS Code | 2937230000 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Lact.
Repr. 1A |
| | Estradiol hemihydrate Usage And Synthesis |
| Uses | Estradiol hemihydrate is a useful research chemical compound. | | Uses | Estradiol hemihydrate (CAS# 35380-71-3) is a useful research chemical compound. It is used in methods of contraception using nomegestrol acetate and estradiol. | | in vivo | Estradiol hemihydrate (1 nM, the hippocampal slices from FBN-ARO-KO mice) rescues long-term potentiation (LTP) amplitude[1].
Estradiol hemihydrate (0.0167 mg, implanted s.c., FBN-ARO-KO mice) rescues the molecular and functional deficits in FBN-ARO-KO mice[1]. | Animal Model: | FBN-ARO-KO Mice[2] | | Dosage: | 1 nM | | Administration: | Treated for the hippocampal slices | | Result: | Rescued long-term potentiation (LTP) amplitude of both male and female mice. |
| Animal Model: | FBN-ARO-KO Mice[2] | | Dosage: | 0.0167 mg | | Administration: | Alzet minipumps with Estradiol (implanted s.c.), examined 7 days after minipump implantation. | | Result: | Restored hippocampal and cortical E2 levels to 93%, phosphorylation of AKT, ERK and CREB in the hippocampus and cortex to 90-95%, BDNF level to 80-90%, restored both synaptophysin and PSD95 in the forebrain.
Rescued the spatial learning and memory defects.
|
|
| | Estradiol hemihydrate Preparation Products And Raw materials |
|