| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
Zirconium carboxyethyl acrylate 60% in & manufacturers
|
| | Zirconium carboxyethyl acrylate 60% in & Basic information |
| | Zirconium carboxyethyl acrylate 60% in & Chemical Properties |
| Boiling point | 100-121 °C | | density | 1.101 g/mL at 25 °C | | Fp | 15℃ | | form | liquid | | Specific Gravity | 1.1 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/4C6H8O4.Zr/c4*1-2-6(9)10-4-3-5(7)8;/h4*2H,1,3-4H2,(H,7,8);/q;;;;+4/p-4 | | InChIKey | XQEXAYLRUODZQC-UHFFFAOYSA-J | | SMILES | C=CC(=O)OCCC(=O)O[Zr](OC(=O)CCOC(=O)C=C)(OC(=O)CCOC(=O)C=C)OC(=O)CCOC(=O)C=C |
| Hazard Codes | F,Xi | | Risk Statements | 11-37/38-41-67 | | Safety Statements | 26-36/37/39-39-16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | Zirconium carboxyethyl acrylate 60% in & Usage And Synthesis |
| Uses | Zirconium-containing multifunctional acrylate useful for producing cured, transparent films with high refractive indices. | | reaction suitability | reagent type: catalyst
core: zirconium |
| | Zirconium carboxyethyl acrylate 60% in & Preparation Products And Raw materials |
|