Phospho-L-TyrosineDisodiumSalt manufacturers
|
| | Phospho-L-TyrosineDisodiumSalt Basic information |
| Product Name: | Phospho-L-TyrosineDisodiumSalt | | Synonyms: | Phospho-L-TyrosineDisodiumSalt;Sodium (S)-2-amino-3-(4-((hydroxyoxidophosphoryl)oxy)phenyl)propanoate;Phospho-L-tyrosine disodium salt;Phospho-L-tyrosine disodium | | CAS: | 1610350-91-8 | | MF: | C9H13NNaO6P | | MW: | 285.17 | | EINECS: | 860-352-3 | | Product Categories: | | | Mol File: | 1610350-91-8.mol |  |
| | Phospho-L-TyrosineDisodiumSalt Chemical Properties |
| density | 1.71g/cm3 at 20℃ | | vapor pressure | 0-0.006Pa at 20-50℃ | | storage temp. | 2-8°C | | form | Solid:crystalline | | PH | 5.5-9.0 (10g/L in H2O) | | biological source | synthetic | | Water Solubility | 25g/L
≤70g/L (in complex feed) | | InChI | InChI=1/C9H12NO6P.Na.H/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15;;/h1-4,8H,5,10H2,(H,11,12)(H2,13,14,15);;/t8-;;/s3 | | InChIKey | BKTHGQJQASQSDE-FGWUPGIONA-N | | SMILES | O(C1C=CC(C[C@H](N)C(=O)O)=CC=1)P(O)(O)=O.[NaH] |&1:6,r| | | LogP | -4.59 at 20℃ and pH7.1-7.2 |
| | Phospho-L-TyrosineDisodiumSalt Usage And Synthesis |
| Uses | Modified amino acids are inhouse manufactured amino acid derivatives with specific properties enabling the intensification of cell culture processes.
Together with the companion product Sulfo-Cysteine sodium salt, the new modified amino acid Phospho-Tyrosine disodium salt can be used as replacement for tyrosine to generate highly concentrated, neutral pH feeds. Both modified amino acids eliminate the need for alkaline feeds, which are normally applied to ensure solubility and stability of the unmodified amino acids tyrosine and cysteine. |
| | Phospho-L-TyrosineDisodiumSalt Preparation Products And Raw materials |
|