|
|
| | 7-Azabenzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate Basic information |
| Product Name: | 7-Azabenzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate | | Synonyms: | 7-Azabenzotriazol-1-yloxytris(dimethylamino)phosph;7-Azabenzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate;7-Aza-1H-benzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate;AOP [7-(Azabenzotriazol-1-yl)oxy tris(dimethylamino)phosphonium hexafluorosphate];7-Aza-1H-benzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate, 98+%;7-Azabenzotriazol-1-yloxytris(dimethyamino) phosphonium hexafluorosphate;AOP;Tris(dimethylamino)(3H-1,2,3-triazolo[4,5-b]pyridin-3-yloxy)phosphorus hexafluorophosphate | | CAS: | 156311-85-2 | | MF: | C11H21F6N7OP2 | | MW: | 443.27 | | EINECS: | 681-486-7 | | Product Categories: | All Aliphatics;Aliphatics | | Mol File: | 156311-85-2.mol |  |
| | 7-Azabenzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate Chemical Properties |
| Melting point | 180°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C11H21N7OP.F6P/c1-15(2)20(16(3)4,17(5)6)19-18-11-10(13-14-18)8-7-9-12-11;1-7(2,3,4,5)6/h7-9H,1-6H3;/q+1;-1 | | InChIKey | RQBNNDQCKMIUQJ-UHFFFAOYSA-N | | SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[P+](N(C)C)(N(C)C)(N(C)C)ON1N=NC2C=CC=NC1=2 | | CAS DataBase Reference | 156311-85-2(CAS DataBase Reference) |
| | 7-Azabenzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate Usage And Synthesis |
| Chemical Properties | White to almost white crystalline powder | | Uses | An intermediate in the synthesis of biotin. Pimeloyl-CoA is transformed into AOP in the presence of L-alanine by the enzyme AOP synthase. The catalytic mechanism of AOP synthase has been studied for the elucidation of inhibitors as potential antimi |
| | 7-Azabenzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate Preparation Products And Raw materials |
|