|
|
| | Methylcarbamic acid phenyl ester Basic information |
| Product Name: | Methylcarbamic acid phenyl ester | | Synonyms: | Methylcarbamic acid phenyl ester;CARBAMICACID,METHYL-,PHENYLESTER;PHENYL-N-METHYL-CARBAMATE;N-METHYLPHENYLCARBAMATE;N-Methylcarbamic acid phenyl ester;Phenmec;Carbamic acid,N-methyl-, phenyl ester;Pyriproxyfen Impurity 2 | | CAS: | 1943-79-9 | | MF: | C8H9NO2 | | MW: | 151.16 | | EINECS: | 815-597-0 | | Product Categories: | | | Mol File: | 1943-79-9.mol |  |
| | Methylcarbamic acid phenyl ester Chemical Properties |
| Melting point | 86 °C | | Boiling point | 273.17°C (rough estimate) | | density | 1.2023 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 11.54±0.46(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | 5g/L at 25℃ | | InChI | InChI=1S/C8H9NO2/c1-9-8(10)11-7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10) | | InChIKey | SCWKRWCUMCMVPW-UHFFFAOYSA-N | | SMILES | C(OC1=CC=CC=C1)(=O)NC | | EPA Substance Registry System | Phenyl methylcarbamate (1943-79-9) |
| | Methylcarbamic acid phenyl ester Usage And Synthesis |
| Uses | Phenyl N-Methylcarbamate can be used as a biomarker for colorectal cancer. It also used an insecticide. |
| | Methylcarbamic acid phenyl ester Preparation Products And Raw materials |
|