|
|
| | 1-(4-Bromo-3-Hydroxyphenyl)Ethanone Basic information |
| Product Name: | 1-(4-Bromo-3-Hydroxyphenyl)Ethanone | | Synonyms: | 1-(4-Bromo-3-Hydroxyphenyl)Ethanone;1-(4-bromo-3-hydroxyphenyl)ethan-1-one;Ethanone, 1-(4-bromo-3-hydroxyphenyl)-;4-Bromo-3-hydroxyacetophenone | | CAS: | 73898-22-3 | | MF: | C8H7BrO2 | | MW: | 215.04 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 1-(4-Bromo-3-Hydroxyphenyl)Ethanone Chemical Properties |
| Melting point | 122–123°C | | Boiling point | 310.5±32.0 °C(Predicted) | | density | 1.586±0.06 g/cm3(Predicted) | | pka | 7.61±0.10(Predicted) | | InChI | InChI=1S/C8H7BrO2/c1-5(10)6-2-3-7(9)8(11)4-6/h2-4,11H,1H3 | | InChIKey | DLSQLGHKHPBHQB-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(Br)C(O)=C1)C |
| | 1-(4-Bromo-3-Hydroxyphenyl)Ethanone Usage And Synthesis |
| Preparation | Preparation by diazotization of 5-amino-3-bromo-2- hydroxyacetophenone, followed by hydrolysis of the obtained diazonium salt (52%). |
| | 1-(4-Bromo-3-Hydroxyphenyl)Ethanone Preparation Products And Raw materials |
|