- fenoxanil
-
- $0.00 / 25kg
-
2025-12-01
- CAS:115852-48-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- Fenoxanil
-
- $0.00 / 1000g
-
2025-11-18
- CAS:115852-48-7
- Min. Order: 1g
- Purity: 95.0%
- Supply Ability: 10 Tons Min
- Fenoxanil
-
- $1.00 / 1g
-
2020-01-15
- CAS:115852-48-7
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 1000KGS
|
| | Fenoxanil Basic information |
| Product Name: | Fenoxanil | | Synonyms: | FENOXANIL;BENZOPURPURINE 4 B (C.I. 23500);zarilamid;N-(1-CYANO-1,2-DIMETHYLPROPYL)-2-(2,4-DICHLOROPHENOXY)PROPIONAMIDE;ac382042;fenoxanil (bsi,iso);Fenoxanil [iso];Fenoxanil@100 μg/mL in Methanol | | CAS: | 115852-48-7 | | MF: | C15H18Cl2N2O2 | | MW: | 329.22 | | EINECS: | | | Product Categories: | | | Mol File: | 115852-48-7.mol |  |
| | Fenoxanil Chemical Properties |
| Melting point | 69.0-71.5° | | Boiling point | 504.9±50.0 °C(Predicted) | | density | d20 1.22 g/cm3 | | storage temp. | 0-6°C | | solubility | DMSO (Slightly), Methanol (Very Slightly, Sonicated) | | pka | 11.44±0.46(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C15H18Cl2N2O2/c1-9(2)15(4,8-18)19-14(20)10(3)21-13-6-5-11(16)7-12(13)17/h5-7,9-10H,1-4H3,(H,19,20) | | InChIKey | IUOKJNROJISWRO-UHFFFAOYSA-N | | SMILES | C(NC(C#N)(C)C(C)C)(=O)C(OC1=CC=C(Cl)C=C1Cl)C | | CAS DataBase Reference | 115852-48-7(CAS DataBase Reference) |
| WGK Germany | 2 | | HS Code | 29269090 | | Toxicity | LD50 orally in mice, male rats, female rats (mg/kg): >5000, >5000, 4211 (Sieverding) |
| | Fenoxanil Usage And Synthesis |
| Uses | Agricultural fungicide. | | Uses | Fenoxanil (cas# 115852-48-7) is an amide fungicide | | Definition | ChEBI: N-(2-cyano-3-methylbutan-2-yl)-2-(2,4-dichlorophenoxy)propanamide is a monocarboxylic acid amide obtained by formal condensation of the carboxy group of 2-(2,4-dichlorophenoxy)propanoic acid with the amino group of 2-amino-2,3-dimethylbutanenitrile. It is a monocarboxylic acid amide, a dichlorobenzene, a nitrile and an aromatic ether. |
| | Fenoxanil Preparation Products And Raw materials |
|