|
|
| | (S)-3-(Boc-amino)-4-phenylbutyric acid Basic information |
| | (S)-3-(Boc-amino)-4-phenylbutyric acid Chemical Properties |
| Melting point | 101-107 °C | | Boiling point | 444.8±38.0 °C(Predicted) | | density | 1.139 | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 4.43±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | [α]20/D 19.0±2°, c = 1% in methylene chloride | | BRN | 3060457 | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c1-15(2,3)20-14(19)16-12(10-13(17)18)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | ACKWQHCPHJQANL-LBPRGKRZSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccccc1 | | CAS DataBase Reference | 51871-62-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | (S)-3-(Boc-amino)-4-phenylbutyric acid Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | Synthesis | Chiral (S)-3-(Boc-amino)-4-phenylbutyric acid is a carboxylic organic compound, and it has been reported in the literature that chiral N-Boc-3-arylmethyl-5-oxoisoxazoles can be synthesized in a one-pot synthesis by a sequential reaction such as cross-complex decomposition reaction, asymmetric conjugate addition reaction, and oxidative reaction using allyl aromatic compounds with crotonaldehyde as starting materials.
|
| | (S)-3-(Boc-amino)-4-phenylbutyric acid Preparation Products And Raw materials |
|