| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-(1-Piperazinyl)pyrimidine dihydrochloride Basic information |
| | 2-(1-Piperazinyl)pyrimidine dihydrochloride Chemical Properties |
| Melting point | 282-287 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | White to very slightly beige | | Sensitive | Hygroscopic | | BRN | 151178 | | InChI | 1S/C8H12N4.2ClH/c1-2-10-8(11-3-1)12-6-4-9-5-7-12;;/h1-3,9H,4-7H2;2*1H | | InChIKey | ZNZGJSLHXOMREP-UHFFFAOYSA-N | | SMILES | Cl[H].Cl[H].C1CN(CCN1)c2ncccn2 | | CAS DataBase Reference | 94021-22-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | UV9702000 | | F | 3-10 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(1-Piperazinyl)pyrimidine dihydrochloride Usage And Synthesis |
| Chemical Properties | WHITE TO VERY SLIGHTLY BEIGE POWDER | | Uses | 1-(2-Pyrimidinyl)piperazine-d8 (2-Piperazinylpyrimidine-d8) dihydrochloride is deuterium-labeled 1-(2-Pyrimidinyl)piperazine dihydrochloride (HY-W004148)[1]. | | in vivo | Isotopic labels can non-invasively track the distribution, transformation and clearance of compounds and their metabolites in the body through techniques such as mass spectrometry (MS) and nuclear magnetic resonance (NMR), which is beneficial to the study of pharmacometabolic kinetics (ADME).
Isotope labeling can reveal specific steps in metabolic pathways. Using compounds with stable isotope labels at specific locations directly in humans or animal models can also help verify drug mechanisms and evaluate unexpected side effects, improving the accuracy and efficiency of clinical research[3]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110
[2] Smith K A, et al. Soil and environmental analysis[M]. Marcel Dekker Incorporated, 2000.
[3] Fan T W M, et al. Stable isotope-resolved metabolomics and applications for drug development[J]. Pharmacology & therapeutics, 2012, 133(3): 366-391. DOI:10.1016/j.pharmthera.2011.12.007 |
| | 2-(1-Piperazinyl)pyrimidine dihydrochloride Preparation Products And Raw materials |
|