|
|
| | Benzene, 1,3,5-trifluoro-2-methoxy- (9CI) Basic information |
| Product Name: | Benzene, 1,3,5-trifluoro-2-methoxy- (9CI) | | Synonyms: | Benzene, 1,3,5-trifluoro-2-methoxy- (9CI);1,3,5-Trifluoro-2-Methoxybenzene;Benzene, 1,3,5-trifluoro-2-methoxy-;Benzene, 1,3,5-trifluoro-2-methoxy- (9CI) ISO 9001:2015 REACH | | CAS: | 219998-30-8 | | MF: | C7H5F3O | | MW: | 162.11 | | EINECS: | | | Product Categories: | HALIDE | | Mol File: | 219998-30-8.mol |  |
| | Benzene, 1,3,5-trifluoro-2-methoxy- (9CI) Chemical Properties |
| refractive index | 1.4400 | | Fp | 35°(95°F) | | form | liquid | | color | Clear | | InChI | InChI=1S/C7H5F3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3 | | InChIKey | ZLRIBYUOFAKHEF-UHFFFAOYSA-N | | SMILES | C1(F)=CC(F)=CC(F)=C1OC |
| RIDADR | UN3271 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2909309090 |
| | Benzene, 1,3,5-trifluoro-2-methoxy- (9CI) Usage And Synthesis |
| | Benzene, 1,3,5-trifluoro-2-methoxy- (9CI) Preparation Products And Raw materials |
|