|
|
| | Carbamic acid, (4-aminopentyl)-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, (4-aminopentyl)-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, (4-aminopentyl)-, 1,1-dimethylethyl ester (9CI);CarbaMic acid, (4-aMinopentyl)-, 1,1-diMethylethyl ester;(4-Aminopentyl)carbamic acid tert-butyl ester;TERT-BUTYL (4-AMINOPENTYL)CARBAMATE;tert-butyl N-(4-aminopentyl)carbamate;Carbamic acid, N-(4-aminopentyl)-, 1,1-dimethylethyl ester;1,1-Dimethylethyl (4-Aminopentyl)carbamate | | CAS: | 701255-53-0 | | MF: | C10H22N2O2 | | MW: | 202.29 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 701255-53-0.mol |  |
| | Carbamic acid, (4-aminopentyl)-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 303℃ | | density | 0.963 | | Fp | 137℃ | | pka | 12.87±0.46(Predicted) | | InChI | InChI=1S/C10H22N2O2/c1-8(11)6-5-7-12-9(13)14-10(2,3)4/h8H,5-7,11H2,1-4H3,(H,12,13) | | InChIKey | ZKHKPODEOGTTJH-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCC(N)C |
| | Carbamic acid, (4-aminopentyl)-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| | Carbamic acid, (4-aminopentyl)-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|