Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (S)- (9CI) manufacturers
|
| | Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (S)- (9CI) Basic information |
| Product Name: | Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (S)- (9CI) | | Synonyms: | Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (S)- (9CI);methyl (1S)-3-oxocyclopentane-1-carboxylate;(S)-3-Oxo-cyclopentanecarboxylic acid methyl ester;Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (1S)-;methyl (S)-3-oxocyclopentane-1-carboxylate;Methyl (S)-3-Oxocyclopentanecarboxylate;(S)-Methyl 3-oxocyclopentanecarboxylate | | CAS: | 132076-32-5 | | MF: | C7H10O3 | | MW: | 142.15 | | EINECS: | | | Product Categories: | CARBOXYLICESTER | | Mol File: | 132076-32-5.mol |  |
| | Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (S)- (9CI) Chemical Properties |
| Boiling point | 209.7±33.0 °C(Predicted) | | density | 1.157±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | form | A neat oil | | Appearance | colorless liquid | | InChI | InChI=1S/C7H10O3/c1-10-7(9)5-2-3-6(8)4-5/h5H,2-4H2,1H3/t5-/m0/s1 | | InChIKey | KTGCFXSELRVRFH-YFKPBYRVSA-N | | SMILES | [C@H]1(C(OC)=O)CCC(=O)C1 |
| | Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (S)- (9CI) Usage And Synthesis |
| Description | (S)-3-Oxo-cyclopentanecarboxylic acid methyl ester is a synthetic intermediate useful for pharmaceutical synthesis. | | Uses | (S)-3-Oxo-cyclopentanecarboxylic acid methyl ester is a synthetic intermediate useful for pharmaceutical synthesis. |
| | Cyclopentanecarboxylic acid, 3-oxo-, methyl ester, (S)- (9CI) Preparation Products And Raw materials |
|