| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Carbamic acid, (3-methylenecyclobutyl)-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, (3-methylenecyclobutyl)-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, (3-methylenecyclobutyl)-, 1,1-dimethylethyl ester (9CI);N-Boc-3-methylene-cyclobutanamine;CarbaMic acid, N-(3-Methylenecyclobutyl)-, 1,1-diMethylethyl ester;tert-butyl (3-methylidenecyclobutyl)carbamate;(3-Methylenecyclobutyl)carbamic acid 1,1-dimethylethyl ester;1-(Boc-amino)-3-methylenecyclobutane;tert-butyl N-(3-methylenecyclobutyl)carbamate;tert-butyl N-(3-methylidenecyclobutyl)carbamate | | CAS: | 130369-04-9 | | MF: | C10H17NO2 | | MW: | 183.25 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 130369-04-9.mol |  |
| | Carbamic acid, (3-methylenecyclobutyl)-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Melting point | 95-100°C | | Boiling point | 263.8±20.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 12.22±0.20(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C10H17NO2/c1-7-5-8(6-7)11-9(12)13-10(2,3)4/h8H,1,5-6H2,2-4H3,(H,11,12) | | InChIKey | UKVCZCZNTKQCCW-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NC1CC(=C)C1 |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | Carbamic acid, (3-methylenecyclobutyl)-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| | Carbamic acid, (3-methylenecyclobutyl)-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|