| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | Acetic acid, 2-[(6-benzo[b]thien-2-ylthieno[2,3-d]pyrimidin-4-yl)thio]- Basic information |
| | Acetic acid, 2-[(6-benzo[b]thien-2-ylthieno[2,3-d]pyrimidin-4-yl)thio]- Chemical Properties |
| Boiling point | 641.5±55.0 °C(Predicted) | | density | 1.59±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | pka | 2.99±0.10(Predicted) | | form | powder | | color | White to very dark grey | | InChI | 1S/C16H10N2O2S3/c19-14(20)7-21-15-10-6-13(23-16(10)18-8-17-15)12-5-9-3-1-2-4-11(9)22-12/h1-6,8H,7H2,(H,19,20) | | InChIKey | RRIRDIKTUQVZCW-UHFFFAOYSA-N | | SMILES | OC(CSC1=C2C=C(C3=CC4=CC=CC=C4S3)SC2=NC=N1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Acetic acid, 2-[(6-benzo[b]thien-2-ylthieno[2,3-d]pyrimidin-4-yl)thio]- Usage And Synthesis |
| Biological Activity | SGC-STK17B-1N is a negative control for SGC-STK17B-1 a cell penetrant, potent and selective inhibitor of STK17B/DRAK2 kinase. |
| | Acetic acid, 2-[(6-benzo[b]thien-2-ylthieno[2,3-d]pyrimidin-4-yl)thio]- Preparation Products And Raw materials |
|