|
|
| | 5-Pyrimidinol, 2,4-dimethyl- (9CI) Basic information |
| Product Name: | 5-Pyrimidinol, 2,4-dimethyl- (9CI) | | Synonyms: | 5-Pyrimidinol, 2,4-dimethyl- (9CI);2,4-Dimethyl-5-pyrimidinol;2,4-DiMethylpyriMidin-5-ol;5-Pyrimidinol,2,4-dimethyl-;2,4-dimethylpyrimidine-5-ol;5-hydroxy-2,4-dimethylpyrimidine;5-Pyrimidinol, 2,4-dimethyl- (9CI) ISO 9001：2015 REACH;Lemborexant intermediates 1 5-Pyrimidinol, 2,4-dimethyl- (9CI) | | CAS: | 412003-95-3 | | MF: | C6H8N2O | | MW: | 124.14 | | EINECS: | | | Product Categories: | alcohol;PYRIMIDINE;412003-95-3 | | Mol File: | 412003-95-3.mol |  |
| | 5-Pyrimidinol, 2,4-dimethyl- (9CI) Chemical Properties |
| Boiling point | 219.7±20.0 °C(Predicted) | | density | 1.161±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 7.28±0.28(Predicted) | | Appearance | Light yellow to light brown Solid | | InChI | InChI=1S/C6H8N2O/c1-4-6(9)3-7-5(2)8-4/h3,9H,1-2H3 | | InChIKey | NJRAXBYJSOFRQV-UHFFFAOYSA-N | | SMILES | C1(C)=NC=C(O)C(C)=N1 |
| | 5-Pyrimidinol, 2,4-dimethyl- (9CI) Usage And Synthesis |
| | 5-Pyrimidinol, 2,4-dimethyl- (9CI) Preparation Products And Raw materials |
|