|
| Allyl-α-D-galactopyranoside Basic information |
| Allyl-α-D-galactopyranoside Chemical Properties |
Melting point | 141-145 °C(lit.) | Boiling point | 415.0±45.0 °C(Predicted) | density | 1.37±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | solubility | Methanol (Slightly), Water (Slightly) | form | Solid | pka | 13.01±0.70(Predicted) | color | White to Off-White | Optical Rotation | [α]20/D +175°, c = 1.5 in H2O | InChI | InChI=1/C9H16O6/c1-2-3-14-9-8(13)7(12)6(11)5(4-10)15-9/h2,5-13H,1,3-4H2/t5-,6+,7+,8-,9+/s3 | InChIKey | XJNKZTHFPGIJNS-NXRLNHOXSA-N | SMILES | [C@@H]1(OCC=C)[C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O |&1:0,5,7,8,10,r| | CAS DataBase Reference | 48149-72-0(CAS DataBase Reference) |
WGK Germany | 3 | HS Code | 29400090 |
| Allyl-α-D-galactopyranoside Usage And Synthesis |
Chemical Properties | Off-White Crystalline Solid | Uses | Allyl-α-D-galactopyranoside can be used as a useful synthetic intermediate for oligosaccharide synthesis. |
| Allyl-α-D-galactopyranoside Preparation Products And Raw materials |
|