2-NITROTHIOPHENOL manufacturers
- 2-Nitrothiophenol
-
- $0.10 / 1KG
-
2025-12-24
- CAS:4875-10-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000 tons
- 2-NITROTHIOPHENOL
-
- $1.10 / 1g
-
2025-11-18
- CAS:4875-10-9
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 2-NITROTHIOPHENOL Basic information |
| Product Name: | 2-NITROTHIOPHENOL | | Synonyms: | 2-NITROTHIOPHENOL;2-Nitro-benzenethiol;o-Nitrothiophenol;o-Nitromercaptobenzene;2-Nitrobenzene-1-thiol;2-Nitrobenzenethiol, 2-Sulphanylnitrobenzene, 2-Thionitrobenzene;Benzenethiol, 2-nitro-;2-NITROTHIOPHENOL ISO 9001:2015 REACH | | CAS: | 4875-10-9 | | MF: | C6H5NO2S | | MW: | 155.17 | | EINECS: | | | Product Categories: | | | Mol File: | 4875-10-9.mol |  |
| | 2-NITROTHIOPHENOL Chemical Properties |
| Melting point | 56 °C | | Boiling point | 262.5±23.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | pka | 5.10±0.43(Predicted) | | InChI | InChI=1S/C6H5NO2S/c8-7(9)5-3-1-2-4-6(5)10/h1-4,10H | | InChIKey | JKIFPWHZEZQCQA-UHFFFAOYSA-N | | SMILES | C1(S)=CC=CC=C1[N+]([O-])=O |
| | 2-NITROTHIOPHENOL Usage And Synthesis |
| | 2-NITROTHIOPHENOL Preparation Products And Raw materials |
|