|
|
| | 3-BROMO-2-CHLORO-5-NITRO-6-PICOLINE Basic information |
| Product Name: | 3-BROMO-2-CHLORO-5-NITRO-6-PICOLINE | | Synonyms: | 3-BROMO-2-CHLORO-5-NITRO-6-PICOLINE;3-Bromo-2-chloro-6-methyl-5-nitropyridine;5-Bromo-6-chloro-3-nitro-2-picoline;3-bromo-2-chloro-5-nitro-6-picolin;2-Picoline, 5-bromo-6-chloro-3-nitro-;2-Chloro-3-bromo-5-nitro-6-methylpyridine;Pyridine, 3-bromo-2-chloro-6-methyl-5-nitro-;3-BROMO-2-CHLORO-5-NITRO-6-PICOLINE ISO 9001：2015 REACH | | CAS: | 856834-95-2 | | MF: | C6H4BrClN2O2 | | MW: | 251.47 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 3-BROMO-2-CHLORO-5-NITRO-6-PICOLINE Chemical Properties |
| Melting point | 93℃ | | Boiling point | 296℃ | | density | 1.810 | | Fp | 133℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -4.03±0.10(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H4BrClN2O2/c1-3-5(10(11)12)2-4(7)6(8)9-3/h2H,1H3 | | InChIKey | WKGHUAZJNBXABN-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=C([N+]([O-])=O)C=C1Br |
| HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-BROMO-2-CHLORO-5-NITRO-6-PICOLINE Usage And Synthesis |
| Chemical Properties | light yellow crystal powder | | Synthesis | 3-Bromo-6-methyl-5-nitropyridin-2-ol (9.2 g, 36.7 mmol) was used as starting material, which was dissolved in phosphorus oxychloride (POCl3, 56.2 g, 366.7 mmol). The reaction mixture was stirred and reacted at 80 °C overnight. Upon completion of the reaction, the mixture was slowly poured into water (800 mL) and the solid product was precipitated. The solid was collected by filtration and dried to afford the target compound 3-bromo-2-chloro-5-nitro-6-methylpyridine (7.5 g, 81.4% yield). | | References | [1] Patent: US2018/170909, 2018, A1. Location in patent: Paragraph 1925; 1926
[2] Patent: WO2015/89192, 2015, A1. Location in patent: Paragraph 00275; 00276
[3] Patent: WO2016/37005, 2016, A1. Location in patent: Paragraph 00259-00260
[4] Patent: WO2008/101682, 2008, A2. Location in patent: Page/Page column 42-43 |
| | 3-BROMO-2-CHLORO-5-NITRO-6-PICOLINE Preparation Products And Raw materials |
|