|
|
| | 3-Chloro-4-fluorobenzaldehyde Basic information |
| | 3-Chloro-4-fluorobenzaldehyde Chemical Properties |
| Melting point | 28-30 °C (lit.) | | Boiling point | 66 °C | | density | 1.3310 (estimate) | | refractive index | 1.544-1.546 | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | form | Liquid After Melting | | color | Clear light yellow | | FreezingPoint | 22.0 to 25.0 ℃ | | Sensitive | Air Sensitive | | BRN | 1857885 | | InChI | InChI=1S/C7H4ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H | | InChIKey | GVORVQPNNSASDM-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(F)C(Cl)=C1 | | CAS DataBase Reference | 34328-61-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-28-36-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29130000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Chloro-4-fluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | Colorlesstolightyellowliqiu | | Uses | 3-Chloro-4-fluorobenzaldehyde was used in synthesis of triclosan analogs bearing isoxazole group on ring. |
| | 3-Chloro-4-fluorobenzaldehyde Preparation Products And Raw materials |
|