L-Threonine-D5 manufacturers
- L-Threonine-D5
-
-
2023-05-27
- CAS:1217456-38-6
- Min. Order: 1mg
- Purity: 96%
- Supply Ability: 50mg
|
| | L-Threonine-D5 Basic information |
| | L-Threonine-D5 Chemical Properties |
| Melting point | 256°C (dec.) | | Boiling point | 345.803±32.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.307±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 2.186±0.10(predicted) | | form | powder | | color | White to off-white | | InChI | 1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i1D3,2D,3D | | InChIKey | AYFVYJQAPQTCCC-WKHZCAFQSA-N | | SMILES | [2H]C([2H])([2H])[C@@]([2H])(O)[C@]([2H])(N)C(O)=O | | CAS Number Unlabeled | 72-19-5 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | L-Threonine-D5 Usage And Synthesis |
| Uses | L-Threonine-d5 is the deuterium labeled L-Threonine. L-Threonine is a natural amino acid, can be produced by microbial fermentation, and is used in food, medicine, or feed[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Threonine-D5 Preparation Products And Raw materials |
|