|
|
| | 1-(4-Methoxy-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Basic information |
| | 1-(4-Methoxy-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Chemical Properties |
| form | solid | | InChI | 1S/C12H13NO4/c1-17-10-4-2-9(3-5-10)13-7-8(12(15)16)6-11(13)14/h2-5,8H,6-7H2,1H3,(H,15,16) | | InChIKey | JIKAEHOGWAHVIJ-UHFFFAOYSA-N | | SMILES | N2(CC(CC2=O)C(=O)O)c1ccc(cc1)OC |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | RIDADR | UN 2811 6.1 / PGIII | | HazardClass | IRRITANT | | HS Code | 2933790090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |
| | 1-(4-Methoxy-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Usage And Synthesis |
| Uses | 1-(4-Methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| | 1-(4-Methoxy-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid Preparation Products And Raw materials |
|