| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Ibuprofen Acyl-β-D-glucuronide (Mixture of diastereoMers)
CAS:115075-59-7
Package:10Mg,1Mg
|
| Company Name: |
Chemsky（shanghai）International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:Ibuprofen Acyl-β-D-glucuronide (Mixture of diastereoMers)
CAS:115075-59-7
Purity:98%
|
| Company Name: |
Artis Chemistry (Shanghai) Co. Ltd.
|
| Tel: |
86-21-60936353 |
| Email: |
|
| Products Intro: |
Product Name:Ibuprofen Acyl-β-D-glucuronide (mixture of diastereomers);1-[α-Methyl-4-(2-methylpropyl)benzeneacetate] β-D-Glucopyranuronic Acid
CAS:115075-59-7
Purity:99% HPLC Package:10mg; 100mg; 500mg
|
|
| | Ibuprofen Acyl-b-D-glucuronide Basic information |
| Product Name: | Ibuprofen Acyl-b-D-glucuronide | | Synonyms: | (R,S)-Ibuprofen-acyl-beta-D-glucuronide;1-[alpha-Methyl-4-(2-methylpropyl)benzeneacetate] -D-Glucopyranuronic acid;ibuprofen acyl glucuronide;1-[a-Methyl-4-(2-methylpropyl)benzeneacetate] -D-Glucopyranuronic Acid;Ibuprofen Acyl--D-glucuronide;Ibuprofen Acyl-β-D-glucuronide (mixture of diastereomers);(R,S)-Ibuprofen-acyl-beta-D-glucuronide min. 98%;Ibuprofen Acyl-beta-D- Glucuronide | | CAS: | 115075-59-7 | | MF: | C19H26O8 | | MW: | 382.4 | | EINECS: | | | Product Categories: | Glucuronides;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 115075-59-7.mol |  |
| | Ibuprofen Acyl-b-D-glucuronide Chemical Properties |
| Melting point | 26-28°C | | Boiling point | 567.3±50.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Acetonitrile (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Sonicated) | | pka | 2.68±0.70(Predicted) | | color | White to Pale Yellow | | Stability: | Hygroscopic, Not stable in aqueous solutions. | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChIKey | ABOLXXZAJIAUGR-JPMMFUSZSA-N | | SMILES | CC(C)Cc1ccc(cc1)C(C)C(=O)O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O |
| WGK Germany | 3 | | HS Code | 2932990090 | | Storage Class | 11 - Combustible Solids |
| | Ibuprofen Acyl-b-D-glucuronide Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Ibuprofen Acyl-β-D-glucuronide (mixture of diastereomers) (cas# 115075-59-7) is a compound useful in organic synthesis. | | Definition | ChEBI: 1-(alpha-Methyl-4-(2-methylpropyl)benzeneacetate)-beta-D-Glucopyranuronic acid is a terpene glycoside. |
| | Ibuprofen Acyl-b-D-glucuronide Preparation Products And Raw materials |
|