ISOPROPYLUREA manufacturers
- ISOPROPYLUREA
-
-
2026-06-30
- CAS:691-60-1
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- Isopropylurea
-
-
2025-11-19
- CAS:691-60-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000kg
|
| | ISOPROPYLUREA Basic information |
| Product Name: | ISOPROPYLUREA | | Synonyms: | (1-methylethyl)-ure;(1-methylethyl)urea;isopropyl-ure;N-(1-methylethyl)urea;N-Isopropylurea;Urea, (1-methylethyl)-;Urea, isopropyl-;urea,(1-methylethyl)- | | CAS: | 691-60-1 | | MF: | C4H10N2O | | MW: | 102.14 | | EINECS: | 211-722-2 | | Product Categories: | | | Mol File: | 691-60-1.mol |  |
| | ISOPROPYLUREA Chemical Properties |
| Melting point | 154.25°C | | Boiling point | 191.46°C (rough estimate) | | density | 1.0739 (rough estimate) | | refractive index | 1.4386 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 14.08±0.46(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H10N2O/c1-3(2)6-4(5)7/h3H,1-2H3,(H3,5,6,7) | | InChIKey | LZMATGARSSLFMQ-UHFFFAOYSA-N | | SMILES | N(C(C)C)C(N)=O | | EPA Substance Registry System | Urea, (1-methylethyl)- (691-60-1) |
| TSCA | TSCA listed | | HS Code | 2924190090 |
| | ISOPROPYLUREA Usage And Synthesis |
| Uses | Isopropylurea, can be used in the synthesis of ymmetrical and unsymmetrical urea analogues having H+/K+-ATPase and anti-inflammatory activities in vitro. |
| | ISOPROPYLUREA Preparation Products And Raw materials |
|