|
|
| | 2-(Trifluoromethyl)isonicotinic acid Basic information |
| | 2-(Trifluoromethyl)isonicotinic acid Chemical Properties |
| Melting point | 217-223℃ | | Boiling point | 338.9±42.0 °C(Predicted) | | density | 1.484±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | pka | 2.94±0.10(Predicted) | | color | Off-white | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)5-3-4(6(12)13)1-2-11-5/h1-3H,(H,12,13) | | InChIKey | BZFGKBQHQJVAHS-UHFFFAOYSA-N | | SMILES | C1(C(F)(F)F)=NC=CC(C(O)=O)=C1 | | CAS DataBase Reference | 131747-41-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | 2-(Trifluoromethyl)isonicotinic acid Usage And Synthesis |
| Uses | 2-(Trifluoromethyl)isonicotinic Acid is useful reactant for the preparation of RAF709 as selective RAF inhibitor targeting RAS mutant cancer. |
| | 2-(Trifluoromethyl)isonicotinic acid Preparation Products And Raw materials |
|