|
|
| | 1-Bromo-3-chloro-2-methylpropane Basic information |
| Product Name: | 1-Bromo-3-chloro-2-methylpropane | | Synonyms: | 3-bromo-1-chloro-2-methylpropane;Propane, 1-bromo-3-chloro-2-methyl-;1-BROMO-3-CHLORO-2-METHYLPROPANE;1-CHLORO-3-BROMO-2-METHYLPROPANE;1-CHLORO-2-METHYL-3-BROMOPROPANE;1-BROMO-3-CHLORO-2-METHYLPROPANE 98%;1-Bromo-3-chloro-2-methylpropa;1-Bromo-2-methyl-3-chloropropane | | CAS: | 6974-77-2 | | MF: | C4H8BrCl | | MW: | 171.46 | | EINECS: | 230-224-6 | | Product Categories: | API intermediates;bc0001 | | Mol File: | 6974-77-2.mol |  |
| | 1-Bromo-3-chloro-2-methylpropane Chemical Properties |
| Boiling point | 152-154 °C(lit.) | | density | 1.467 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4809(lit.) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | solubility | soluble in Methanol,Acetone | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C4H8BrCl/c1-4(2-5)3-6/h4H,2-3H2,1H3 | | InChIKey | ZKDOQFPDSUOLGF-UHFFFAOYSA-N | | SMILES | C(Br)C(C)CCl | | CAS DataBase Reference | 6974-77-2(CAS DataBase Reference) | | NIST Chemistry Reference | Propane, 1-bromo-3-chloro-2-methyl-(6974-77-2) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | HS Code | 2903 79 30 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-Bromo-3-chloro-2-methylpropane Usage And Synthesis |
| Uses | 1-Bromo-3-chloro-2-methylpropane is used as a reagent in the synthesis of N-substituted oxazolo[5,4-b]pyridin-2(1H)-ones as a new class of non-opiate antinociceptive agents. |
| | 1-Bromo-3-chloro-2-methylpropane Preparation Products And Raw materials |
|