ethyl 2-hydrazinyl-2-oxoacetate manufacturers
|
| | ethyl 2-hydrazinyl-2-oxoacetate Basic information |
| Product Name: | ethyl 2-hydrazinyl-2-oxoacetate | | Synonyms: | Ethanedioic acid, monoethyl ester, hydrazide;Ethanedioic acid 1-ethyl ester 2-hydrazide;Ethyl 2-hydrazino-2-oxoacetate;Ethyl carbazoylformate;Ethyl hydrogen oxalate hydrazide;Ethyl oxalyl hydrazide;Monoethyl oxalate hydrazide;Oxalic acid monoethyl ester hydrazide | | CAS: | 35196-48-6 | | MF: | C4H8N2O3 | | MW: | 132.12 | | EINECS: | 213-262-8 | | Product Categories: | | | Mol File: | 35196-48-6.mol |  |
| | ethyl 2-hydrazinyl-2-oxoacetate Chemical Properties |
| Melting point | 50-52℃ | | density | 1.227 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) | | pka | 10.52±0.20(Predicted) | | form | Solid | | color | Off-White | | InChI | InChI=1S/C4H8N2O3/c1-2-9-4(8)3(7)6-5/h2,5H2,1H3,(H,6,7) | | InChIKey | KGGHFXZJDYAHAE-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(NN)=O |
| | ethyl 2-hydrazinyl-2-oxoacetate Usage And Synthesis |
| Chemical Properties | Ethyl 2-hydrazinyl-2-oxoacetate molecular formula is C₄H₈N₂O₃, with a molecular weight of 132.12 g/mol. It is a solid powder at room temperature, with a melting point ranging between 45-53°C. It has two hydrogen bond donors and four hydrogen bond acceptors, exhibits certain water solubility, and needs to be stored sealed at -20°C to ensure stability. |
| | ethyl 2-hydrazinyl-2-oxoacetate Preparation Products And Raw materials |
|