|
|
| | 2,6-dibromo-4-phenyl-phenol Basic information |
| Product Name: | 2,6-dibromo-4-phenyl-phenol | | Synonyms: | 2,6-dibromo-4-phenyl-phenol;3,5-Dibromo-biphenyl-4-ol;[1,1'-Biphenyl]-4-ol, 3,5-dibromo-;3,5-Dibromo-[1,1'-biphenyl]-4-ol | | CAS: | 4400-05-9 | | MF: | C12H8Br2O | | MW: | 328 | | EINECS: | | | Product Categories: | | | Mol File: | 4400-05-9.mol |  |
| | 2,6-dibromo-4-phenyl-phenol Chemical Properties |
| Melting point | 91-94 °C | | Boiling point | 316.7±37.0 °C(Predicted) | | density | 1.768±0.06 g/cm3(Predicted) | | pka | 6.81±0.23(Predicted) | | InChI | InChI=1S/C12H8Br2O/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h1-7,15H | | InChIKey | SKQRVOXIIAXXEM-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC(Br)=C(O)C(Br)=C1 |
| | 2,6-dibromo-4-phenyl-phenol Usage And Synthesis |
| | 2,6-dibromo-4-phenyl-phenol Preparation Products And Raw materials |
|