| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | RUBROPUNCTATIN Basic information |
| Product Name: | RUBROPUNCTATIN | | Synonyms: | RUBROPUNCTATIN;(R)-9a-Methyl-3-(1-oxohexyl)-6-[(E)-1-propenyl]-2H-furo[3,2-g][2]benzopyran-2,9(9aH)-dione;Rubropuncatatin;(R-(E))-9A-Methyl-3-(1-oxohexyl)-6-(1-propenyl)-2H-furo(3,2-G)(2)benzopyran-2,9(9ah)-dione;2H-Furo(3,2-G)(2)benzopyran-2,9(9ah)-dione, 9A-methyl-3-(1-oxohexyl)-6-(1-propenyl)-, (R-(E))-;(9aR)-3-hexanoyl-9a-methyl-6-[(E)-prop-1-enyl]furo[3,2-g]isochromene-2,9-dione;2H-Furo[3,2-g][2]benzopyran-2,9(9aH)-dione, 9a-methyl-3-(1-oxohexyl)-6-(1E)-1-propen-1-yl-, (9aR)- | | CAS: | 514-67-0 | | MF: | C21H22O5 | | MW: | 354.4 | | EINECS: | | | Product Categories: | | | Mol File: | 514-67-0.mol |  |
| | RUBROPUNCTATIN Chemical Properties |
| Melting point | 156.5-157.0 °C (decomp)(Solv: ethyl ether (60-29-7)) | | Boiling point | 638.8±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | form | Solid | | color | Yellow to orange | | InChI | InChI=1S/C21H22O5/c1-4-6-7-9-17(22)18-16-11-13-10-14(8-5-2)25-12-15(13)19(23)21(16,3)26-20(18)24/h5,8,10-12H,4,6-7,9H2,1-3H3/b8-5+/t21-/m1/s1 | | InChIKey | SULYDLFVUNXAMP-WKOQKXSESA-N | | SMILES | C1(/C=C/C)OC=C2C(=O)[C@]3(C)OC(=O)C(C(=O)CCCCC)=C3C=C2C=1 |
| | RUBROPUNCTATIN Usage And Synthesis |
| Uses | Rubropunctatin is used in preparation Method for separating and purifying Rubropunctatin in monascus polished glutinous rice. | | in vivo | Rubropunctatin (8-32 mg/kg; i.v. for 5 times) has anti-tumor effect mice[1].
Rubropunctamine inhibits 12-O-tetradecanoylphorbol-13-acetate (TPA)-induced inflammation in mice, with an ID50 of 0.11 mg/ear[3]. | Animal Model: | Male nude mice (5 weeks) are inoculated with BGC-823 cells[1] | | Dosage: | 8, 32 mg/kg | | Administration: | I.v. five times (day 1st, 4th, 7th, 10th, and 13th) | | Result: | Diminished the tumor volume by 11.1% (8 mg/kg) and 24.2% (32 mg/kg).
Reduced the tumor weight by 23.5% (8 mg/kg) and 37.7% (32 mg/kg).
No significant difference was observed on the body weight.
|
|
| | RUBROPUNCTATIN Preparation Products And Raw materials |
|