| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile Basic information |
| Product Name: | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile | | Synonyms: | 1-(4-CHLORO-PHENYL)-CYCLOPROPANECARBONITRILE;1-(4-Chlorophenyl)-1-cyclopropane- carbonitrile 98%;1-(4-Chlorophenyl)cyclopropane-1-carbonitrile;1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile,98%;1-(p-chlorophenyl)cyclopropanecarbonitrile;4-(1-Cyanocyclopropyl)chlorobenzene;1-[3-[3-[4-(3,4-dimethylphenyl)-1-piperazinyl]-2-hydroxypropoxy]phenyl]ethanone;Cyclopropanecarbonitrile, 1-(4-chlorophenyl)- | | CAS: | 64399-27-5 | | MF: | C10H8ClN | | MW: | 177.63 | | EINECS: | 264-871-0 | | Product Categories: | | | Mol File: | 64399-27-5.mol |  |
| | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile Chemical Properties |
| Melting point | 52-56 °C | | Boiling point | 292.84°C (rough estimate) | | density | 1.1810 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light brown to yellow Solid | | InChI | InChI=1S/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 | | InChIKey | BVWSEHMDAKSWQW-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(Cl)C=C2)(C#N)CC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | HS Code | 29269095 |
| Provider | Language |
|
ACROS
| English |
| | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile Usage And Synthesis |
| Chemical Properties | white crystalline powder, crystals or chunks | | Uses | 1-(4-Chlorophenyl)cyclopropanecarbonitrile |
| | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile Preparation Products And Raw materials |
|