1,2-Cyclohexanediamine,N,N-dimethyl-,(1R,2R)-(9CI) manufacturers
|
| | 1,2-Cyclohexanediamine,N,N-dimethyl-,(1R,2R)-(9CI) Basic information |
| Product Name: | 1,2-Cyclohexanediamine,N,N-dimethyl-,(1R,2R)-(9CI) | | Synonyms: | 1,2-Cyclohexanediamine,N,N-dimethyl-,(1R,2R)-(9CI);(1R,2R)-1-amino-2-(dimethylamino)cyclohexane;(1R,2R)-N1,N1-dimethylcyclohexane-1,2-diamine-2HCl;(1R,2R)-N1,N1-DiMethylcyclohexane-1,2-diaMine dihydrochloride;(1R,2R)-N1,N1-diMethylcyclohexane-1,2-diaMine;(1R,2R)-N',N'-Dimethyl-1,2-diaminocyclohexane;(1R,2R)-N',N'-Dimethyl-1,2-diaminocyclohexane,99%e.e.;1,2-Cyclohexanediamine,N1,N1-dimethyl-, (1R,2R)- | | CAS: | 320778-92-5 | | MF: | C8H18N2 | | MW: | 142.24 | | EINECS: | | | Product Categories: | AMINETERTIARY | | Mol File: | 320778-92-5.mol |  |
| | 1,2-Cyclohexanediamine,N,N-dimethyl-,(1R,2R)-(9CI) Chemical Properties |
| Boiling point | 180℃ | | density | 0.92 | | Fp | 62℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.52±0.70(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H18N2/c1-10(2)8-6-4-3-5-7(8)9/h7-8H,3-6,9H2,1-2H3/t7-,8-/m1/s1 | | InChIKey | FRDZGSBXKJXGNR-HTQZYQBOSA-N | | SMILES | [C@@H]1(N(C)C)CCCC[C@H]1N |
| | 1,2-Cyclohexanediamine,N,N-dimethyl-,(1R,2R)-(9CI) Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | (1R,2R)-2-N,2-N-dimethylcyclohexane-1,2-diamine is a chiral amine catalysts used in asymmetric direct aldol and Michael addition reactions. |
| | 1,2-Cyclohexanediamine,N,N-dimethyl-,(1R,2R)-(9CI) Preparation Products And Raw materials |
|