| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1H-Benzimidazole,2-(2-thienyl)-(9CI) Basic information |
| Product Name: | 1H-Benzimidazole,2-(2-thienyl)-(9CI) | | Synonyms: | 1H-Benzimidazole,2-(2-thienyl)-(9CI);2-(thiophen-2-yl)-1H-benzo[d]iMidazole;2-(2-Thienyl)-1H-benzimidazole;2-(Thiophen-2-yl)benzimidazole;2-(2-Thienyl)-1H-benzimidazole 95%;2-Thiophen-2-yl-1H-benzoimidazole;1H-BenziMidazole, 2-(2-thienyl)-BenziMidazole, 2-(2-thienyl)- (6CI,7CI,8CI);1H-Benzimidazole, 2-(2-thienyl)- | | CAS: | 3878-18-0 | | MF: | C11H8N2S | | MW: | 200.26 | | EINECS: | | | Product Categories: | BENZIMIDAZOLE | | Mol File: | 3878-18-0.mol |  |
| | 1H-Benzimidazole,2-(2-thienyl)-(9CI) Chemical Properties |
| Melting point | 230℃ | | Boiling point | 412.2±37.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | pka | 11.11±0.10(Predicted) | | form | Solid | | color | Yellow to brown | | InChI | 1S/C11H8N2S/c1-2-5-9-8(4-1)12-11(13-9)10-6-3-7-14-10/h1-7H,(H,12,13) | | InChIKey | XXCGVPNWMZKOER-UHFFFAOYSA-N | | SMILES | c1ccc2[nH]c(nc2c1)-c3cccs3 |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 1H-Benzimidazole,2-(2-thienyl)-(9CI) Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 58, p. 7016, 1993 DOI: 10.1021/jo00077a019 |
| | 1H-Benzimidazole,2-(2-thienyl)-(9CI) Preparation Products And Raw materials |
|