- BROMOSUCCINIC ACID
-
- $0.00 / 1KG
-
2025-12-24
- CAS:923-06-8
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
- BROMOSUCCINIC ACID
-
- $100.00 / 1KG
-
2019-07-06
- CAS:923-06-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | BROMOSUCCINIC ACID Basic information |
| | BROMOSUCCINIC ACID Chemical Properties |
| Melting point | 161-163 °C(lit.) | | Boiling point | 255℃ | | density | 2.073 | | refractive index | 1.4620 (estimate) | | Fp | 108℃ | | storage temp. | Refrigerator | | solubility | Insoluble in ether. | | pka | pK1: 2.55;pK2: 4.41 (25°C) | | form | Solid | | color | White | | Water Solubility | 120g/L(15.5 ºC) | | Merck | 14,1437 | | BRN | 1723556 | | InChI | InChI=1S/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9) | | InChIKey | QQWGVQWAEANRTK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(Br)CC(O)=O | | CAS DataBase Reference | 923-06-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-36 | | RIDADR | 1759 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29171990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | BROMOSUCCINIC ACID Usage And Synthesis |
| Chemical Properties | white to off-white crystalline powder | | Uses | Bromosuccinic acid is an important precursor in many chemicals used in the food, chemical and pharmaceutical fields. It is also used as a reagent to prepare L-Hydrazinosuccinic acid. | | Definition | ChEBI: A dicarboxylic acid that is succinic acid substituted at position 2 by a bromine atom. |
| | BROMOSUCCINIC ACID Preparation Products And Raw materials |
|