| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
|
| | 2-aminobutyric acid methyl ester Basic information |
| | 2-aminobutyric acid methyl ester Chemical Properties |
| Boiling point | 48-51 °C(Press: 3 Torr) | | density | 0.987±0.06 g/cm3(Predicted) | | pka | 7.89±0.29(Predicted) | | InChI | InChI=1S/C5H11NO2/c1-3-4(6)5(7)8-2/h4H,3,6H2,1-2H3 | | InChIKey | ZZWPOYPWQTUZDY-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C(N)CC |
| | 2-aminobutyric acid methyl ester Usage And Synthesis |
| | 2-aminobutyric acid methyl ester Preparation Products And Raw materials |
|