- Isofraxidin
-
- $38.00 / 10mg
-
2026-04-22
- CAS:486-21-5
- Min. Order:
- Purity: 99.74%
- Supply Ability: 10g
- Isofraxidin
-
- $0.00 / 20mg
-
2023-02-24
- CAS:486-21-5
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Isofraxidin
-
- $15.00 / 1KG
-
2021-07-13
- CAS:486-21-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Isofraxidin Basic information |
| Product Name: | Isofraxidin | | Synonyms: | 7-hydroxy-6,8-dimethoxy-2h-1-benzopyran-2-on;7-hydroxy-6,8-dimethoxy-2h-1-benzopyran-2-one;7-hydroxy-6,8-dimethoxy-coumari;phytodolor;ISOFRAXIDIN;ISOFRAXIDINE;AKOS 243-93;6,8-DIMETHOXY-7-HYDROXYCOUMARIN | | CAS: | 486-21-5 | | MF: | C11H10O5 | | MW: | 222.19 | | EINECS: | | | Product Categories: | Coumarins | | Mol File: | 486-21-5.mol |  |
| | Isofraxidin Chemical Properties |
| Melting point | 145～147℃ | | Boiling point | 452.1±45.0 °C(Predicted) | | density | 1.358±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 250 mg/mL (1125.16 mM) | | form | Solid | | pka | 7.92±0.20(Predicted) | | color | Yellow to brown | | BRN | 202652 | | InChI | InChI=1S/C11H10O5/c1-14-7-5-6-3-4-8(12)16-10(6)11(15-2)9(7)13/h3-5,13H,1-2H3 | | InChIKey | HOEVRHHMDJKUMZ-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=C(OC)C(O)=C(OC)C=C2C=C1 | | CAS DataBase Reference | 486-21-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | Isofraxidin Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in boiling water, insoluble in cold water, soluble in methanol, ethanol, sodium hydroxide solution, from the swollen knotty wind, prickly five plus bark, grass coral whole plant. | | Uses | Isofraxidin is used as an anti-inflammatory compound. Inhibits pro-inflammatory cytokines. | | Definition | ChEBI: Isofraxidin is a hydroxycoumarin. | | IC 50 | COX-2; TLR4; MMP-7 |
| | Isofraxidin Preparation Products And Raw materials |
|