|
|
| | 4-Bromo-2-fluorobenzoic acid Basic information |
| | 4-Bromo-2-fluorobenzoic acid Chemical Properties |
| Melting point | 211-215 °C (lit.) | | Boiling point | 289.4±25.0 °C(Predicted) | | density | 1.7218 (rough estimate) | | refractive index | 1.4240 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Solubility in methanol, very faint turbidity. | | pka | 3.04±0.10(Predicted) | | form | Solid | | color | White | | BRN | 6323931 | | InChI | InChI=1S/C7H4BrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) | | InChIKey | ZQQSRVPOAHYHEL-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(Br)C=C1F | | CAS DataBase Reference | 112704-79-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 4-bromo-2-fluoro- (112704-79-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids |
| | 4-Bromo-2-fluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Bromo-2-fluorobenzoic Acid is a halogenated derivative of benzoic acid. 4-Bromo-2-fluorobenzoic Acid is used in the synthesis of pharmaceutically significant products such as d-Amino acid oxidase in
hibitors. | | Uses | 4-Bromo-2-fluorobenzoic acid may be used in the synthesis of biaryl intermediates by palladium-mediated coupling with various aryl boronic acids | | General Description | 4-Bromo-2-fluorobenzoic acid is a halogen substituted benzoic acid. |
| | 4-Bromo-2-fluorobenzoic acid Preparation Products And Raw materials |
|